| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Cbz-D-Pro-OL
-
-
2026-09-14
- CAS:72597-18-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- Cbz-D-Prolinol
-
-
2025-04-04
- CAS:72597-18-3
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1Ton
- Cbz-D-Prolinol
-
- $20.00
-
2019-07-06
- CAS:72597-18-3
- Min. Order: 2KG
- Purity: 98%
- Supply Ability: 50kg
|
| | Z-D-PROLINOL, 97 Basic information |
| Product Name: | Z-D-PROLINOL, 97 | | Synonyms: | Z-D-PROLINOL, 97;L-CBZ--D-PROLINOL;(R)-benzyl 2-(hydroxymethyl)pyrrolidine-1-carboxylate;(R)-N-Cbz-prolinol;-Benzyl 2-(hydroxymethyl);N-Carbonylbenzyloxy-D-prolinol;N-Cbz-D-Prolinol;benzyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate | | CAS: | 72597-18-3 | | MF: | C13H17NO3 | | MW: | 235.28 | | EINECS: | | | Product Categories: | | | Mol File: | 72597-18-3.mol |  |
| | Z-D-PROLINOL, 97 Chemical Properties |
| Boiling point | 382.0±25.0 °C(Predicted) | | density | 1.135 g/mL at 25 °C | | refractive index | n 20/D 1.5396 | | Fp | >230 °F | | storage temp. | 2-8°C | | pka | 14.77±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | 53.5° (C=1.05 g/100ml, MEOH) | | Major Application | peptide synthesis | | InChI | 1S/C13H17NO3/c15-9-12-7-4-8-14(12)13(16)17-10-11-5-2-1-3-6-11/h1-3,5-6,12,15H,4,7-10H2/t12-/m1/s1 | | InChIKey | BJTNHGVCFWDNDP-GFCCVEGCSA-N | | SMILES | OC[C@H]1CCCN1C(=O)OCc2ccccc2 |
| Hazard Codes | T | | Risk Statements | 25-36 | | Safety Statements | 26-45 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Irrit. 2 |
| | Z-D-PROLINOL, 97 Usage And Synthesis |
| Chemical Properties | Colorless to orange viscid liquid | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Z-D-PROLINOL, 97 Preparation Products And Raw materials |
|