|
|
| | Bis(phenylethynyl)dimethylsilane Basic information |
| Product Name: | Bis(phenylethynyl)dimethylsilane | | Synonyms: | dimethyl-bis(2-phenylethynyl)silane;Dimethylbis(phenylethynyl)silane;Dimethylbis(phenylethynyl)silane>Benzene, 1,1'-[(dimethylsilylene)di-2,1-ethynediyl]bis- | | CAS: | 2170-08-3 | | MF: | C18H16Si | | MW: | 260.41 | | EINECS: | | | Product Categories: | | | Mol File: | 2170-08-3.mol |  |
| | Bis(phenylethynyl)dimethylsilane Chemical Properties |
| Melting point | 78-81°C | | Boiling point | 180°C 4mm | | Fp | >110°C | | storage temp. | 2-8°C, protect from light | | Appearance | White to off-white Solid | | λmax | 249nm(Cyclohexane)(lit.) | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | InChI=1S/C18H16Si/c1-19(2,15-13-17-9-5-3-6-10-17)16-14-18-11-7-4-8-12-18/h3-12H,1-2H3 | | InChIKey | LRBLIVYQOCFXPX-UHFFFAOYSA-N | | SMILES | [Si](C#CC1=CC=CC=C1)(C#CC1=CC=CC=C1)(C)C | | CAS DataBase Reference | 2170-08-3 |
| | Bis(phenylethynyl)dimethylsilane Usage And Synthesis |
| | Bis(phenylethynyl)dimethylsilane Preparation Products And Raw materials |
|