|
|
| | 1,4-BIS(TRIMETHYLSILYL)-1,3-BUTADIYNE Basic information |
| Product Name: | 1,4-BIS(TRIMETHYLSILYL)-1,3-BUTADIYNE | | Synonyms: | 1,4-BIS-(TRIMETHYLSILYL)-1,3-BUTADIYNE, 98%1,4-BIS-(TRIMETHYLSILYL)-1,3-BUTADIYNE, 98%1,4-BIS-(TRIMETHYLSILYL)-1,3-BUTADIYNE, 98%;1,4-Bis(trimethylsilyl)-1,3-butanediyne;1,4-Bis(trimethylsilyl)-1-butyne-3-yne;1,4-Bis(trimethylsilyl)butane-1,3-diyne;1,4-Di(trimethylsilyl)-1,3-butadiyne;Bis(trimethylsilyl)-1,3-butadiyne;4-Bis(trimethylsilyl)-1,3-butadiyne;1,4-Bis(trimethylsilyl)butadiyne 98%, stable crystalline form of butadiyne | | CAS: | 4526-07-2 | | MF: | C10H18Si2 | | MW: | 194.42 | | EINECS: | 629-258-8 | | Product Categories: | Si-(C)4 Compounds;Silicon Compounds (for Synthesis);Synthetic Organic Chemistry;Diyne Compounds (LB Films);LB Films;Acetylenes;Ethynylsilanes;Functional Materials;Functionalized Acetylenes;Si (Classes of Silicon Compounds);Alkynes;Building Blocks;Chemical Synthesis;Internal;Organic Building Blocks | | Mol File: | 4526-07-2.mol |  |
| | 1,4-BIS(TRIMETHYLSILYL)-1,3-BUTADIYNE Chemical Properties |
| Melting point | 111-113 °C(lit.) | | Boiling point | 197.7±23.0 °C(Predicted) | | density | 0.974 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.384(lit.) | | Fp | >45°C | | storage temp. | 2-8°C | | form | solid | | color | White to Light yellow to Light orange | | Water Solubility | Insoluble in water. | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | BRN | 1758268 | | InChI | InChI=1S/C10H18Si2/c1-11(2,3)9-7-8-10-12(4,5)6/h1-6H3 | | InChIKey | LBNVCJHJRYJVPK-UHFFFAOYSA-N | | SMILES | C([Si](C)(C)C)#CC#C[Si](C)(C)C | | CAS DataBase Reference | 4526-07-2(CAS DataBase Reference) |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 16-22-24/25 | | RIDADR | UN 1325 4.1/PG 2 | | WGK Germany | 3 | | TSCA | No | | HazardClass | 4.1 | | PackingGroup | II | | HS Code | 29319090 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Flam. Sol. 1 |
| | 1,4-BIS(TRIMETHYLSILYL)-1,3-BUTADIYNE Usage And Synthesis |
| Chemical Properties | light yellow to light beige cryst.powder or flakes | | Uses | 1,4-Bis(trimethylsilyl)-1,3-butadiyne is used in Negishi protocol for the synthesis of glycosylated oligo(ethynylene)s. It is also used as pharmaceutical intermediates. | | Uses | 1,4-Bis(trimethylsilyl)butadiyne can be used as a reagent to prepare:
- 1,1,3,4-Tetrasilyl-substituted 1,3-butadienes or 1,1,3,4-tetrasilyl-substituted 1,2-butadienes by hydrosilylation reaction using various hydridosilanes and catalysts.
- Glycosylated oligo(ethynylene)s using the Negishi reaction.
- (±) Falcarinol, a polyacetylene class of fatty alcohol.
|
| | 1,4-BIS(TRIMETHYLSILYL)-1,3-BUTADIYNE Preparation Products And Raw materials |
|