| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(1S,2S,3S,5R)-(+)-IsopinocaMpheylaMine CAS:13293-47-5 Purity:95% Package:1G,5G
|
| Company Name: |
Beijing Ouhe Technology Co., Ltd
|
| Tel: |
010-82967028 13522913783 |
| Email: |
2355560935@qq.com |
| Products Intro: |
Product Name:(+)-ISOPINOCAMPHEYLAMINE CAS:13293-47-5 Purity:98.00% Package:10g;50g;100g;250g;500g
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(1S,2S,3S,5R)-(+)-Isopinocampheylamine CAS:13293-47-5 Purity:95% Package:5G Remarks:391662-5G
|
|
| | (+)-ISOPINOCAMPHEYLAMINE Basic information |
| Product Name: | (+)-ISOPINOCAMPHEYLAMINE | | Synonyms: | (1S,2S,3S,5R)-(+)-Isopinocampheylamine 95%;(1S,2S,3S,5R)-(+)-ISOPINOCAMPHEYLAMINE,97% (1S,2S,3S,5R)-(+)-ISOPINOCAMPHEYLAMINE,95%;(+)-ISOPINOCAMPHEYLAMINE 96+% (GC SUM OF ENANTIOMERS);(1S,2S,3S,5R)-3-Pinanamine;(+)-Isopinocampheylamine, (1S,2S,3S,5R)-3-Pinanamine;Bicyclo[3.1.1]heptan-3-amine, 2,6,6-trimethyl-, (1S,2S,3S,5R)-;(+)-ISOPINOCAMPHEYLAMINE;(1S,2S,3S,5R)-(+)-Isopinocampheylamine | | CAS: | 13293-47-5 | | MF: | C10H19N | | MW: | 153.26 | | EINECS: | | | Product Categories: | | | Mol File: | 13293-47-5.mol |  |
| | (+)-ISOPINOCAMPHEYLAMINE Chemical Properties |
| Boiling point | 90 °C/18 mmHg (lit.) | | density | 0.909 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.481(lit.) | | Fp | 160 °F | | storage temp. | 2-8°C, protect from light | | pka | 11.03±0.60(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | [α]22/D +44°, neat | | InChI | 1S/C10H19N/c1-6-8-4-7(5-9(6)11)10(8,2)3/h6-9H,4-5,11H2,1-3H3/t6-,7+,8-,9-/m0/s1 | | InChIKey | VPTSZLVPZCTAHZ-KZVJFYERSA-N | | SMILES | C[C@@H]1[C@@H](N)C[C@H]2C[C@@H]1C2(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (+)-ISOPINOCAMPHEYLAMINE Usage And Synthesis |
| Uses | (1S,2S,3S,5R)-(+)-isopinocampheylamine is a primary bicyclic amine with potent M2 ion channel inhibitor ability similar to that of amantadine, making it a promising candidate for developing anti-influenza agents. |
| | (+)-ISOPINOCAMPHEYLAMINE Preparation Products And Raw materials |
|