| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1,4-Bis(bromomethyl)-2-methoxy-5-(2-ethylhexyloxy)benzene Basic information |
| Product Name: | 1,4-Bis(bromomethyl)-2-methoxy-5-(2-ethylhexyloxy)benzene | | Synonyms: | 2 5-BIS(BROMOMETHYL)-1-METHOXY-4-(2-;2,5-BIS(BROMOMETHYL)-1-METHOXY-4-(2-ETHY;1,4-Bis(bromomethyl)-2-methoxy-5-(2-ethylhexyloxy)benzene;2,5-Bis(bromomethyl)-4-(2-ethylhexyloxy)anisole, 98%;1,4-bis(bromomethyl)-2-(2-ethylhexoxy)-5-methoxybenzene;2,5-Bis(bromomethyl)-1-methoxy-4-(2-ethylhexyloxy)benzene;2-Methoxy-5-(2-ethylhexyloxy)-1,4-bis(bromomethyl)benzene;1,4-Bis(bromomethyl) | | CAS: | 209625-37-6 | | MF: | C17H26Br2O2 | | MW: | 422.2 | | EINECS: | | | Product Categories: | Organic Electronics and Photonics;Polyphenylenevinylene (PPV, CN-PPV) Monomers;Synthetic Tools and Reagents | | Mol File: | 209625-37-6.mol |  |
| | 1,4-Bis(bromomethyl)-2-methoxy-5-(2-ethylhexyloxy)benzene Chemical Properties |
| Melting point | 82-86 °C(lit.) | | density | 1.351 | | storage temp. | Storage temp. 2-8°C | | Appearance | Off-white to light yellow Solid | | Sensitive | Moisture Sensitive | | InChI | 1S/C17H26Br2O2/c1-4-6-7-13(5-2)12-21-17-9-14(10-18)16(20-3)8-15(17)11-19/h8-9,13H,4-7,10-12H2,1-3H3 | | InChIKey | WFGYUUWEXFKLCS-UHFFFAOYSA-N | | SMILES | CCCCC(CC)COc1cc(CBr)c(OC)cc1CBr | | CAS DataBase Reference | 209625-37-6 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 1759 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 1,4-Bis(bromomethyl)-2-methoxy-5-(2-ethylhexyloxy)benzene Usage And Synthesis |
| Uses | Conducting polymer precursor. |
| | 1,4-Bis(bromomethyl)-2-methoxy-5-(2-ethylhexyloxy)benzene Preparation Products And Raw materials |
|