| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | p-(2-Methoxyethyl) phenol Basic information |
| | p-(2-Methoxyethyl) phenol Chemical Properties |
| Melting point | 42-45 °C(lit.) | | Boiling point | 125 °C / 3mmHg | | density | 1.060±0.06 g/cm3(Predicted) | | vapor pressure | 0.41Pa at 20℃ | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.00±0.15(Predicted) | | color | White to Off-White | | Water Solubility | 8.42g/L at 20℃ | | InChI | InChI=1S/C9H12O2/c1-11-7-6-8-2-4-9(10)5-3-8/h2-5,10H,6-7H2,1H3 | | InChIKey | FAYGEALAEQKPDI-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(CCOC)C=C1 | | LogP | 1.79 at 20℃ | | CAS DataBase Reference | 56718-71-9(CAS DataBase Reference) | | EPA Substance Registry System | Phenol, 4-(2-methoxyethyl)- (56718-71-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29095000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | p-(2-Methoxyethyl) phenol Usage And Synthesis |
| Description | 4-(2-Methoxyethyl)phenol (also known as p-(2-Methoxyethyl)phenol) is the starting material for the synthesis of metoprolol tartrate. Metoprolol tartrate is a selective β₁-blocker used in the treatment of various cardiovascular conditions, particularly hypertension. | | Chemical Properties | White Low Melting Solid | | Uses | 4-(2-Methoxyethyl)phenol is an Impurity of Metoprolol. | | Uses | 4-(2-Methoxyethyl)phenol may be used in the preparation of methyl analog of metoprolol (MAM). | | General Description | 4-(2-Methoxyethyl)phenol can be prepared by reacting methyl vinyl ether and 4-bromonitrobenzene. |
| | p-(2-Methoxyethyl) phenol Preparation Products And Raw materials |
|