|
|
| | 3-Fluoro-4-biphenylboronic acid Basic information |
| Product Name: | 3-Fluoro-4-biphenylboronic acid | | Synonyms: | 3-Fluoro-4-biphenylboronic acid;3-Fluoro-[1,1']-biphenyl-4-boronic acid;2-Fluoro-4-phenylbenzeneboronic acid, 4-Borono-3-fluorobiphenyl;(2-fluoro-4-phenylphenyl)boronic acid;Boronic acid, B-(3-fluoro[1,1'-biphenyl]-4-yl)-;3-Fluoro-4-biphenylboronicaci;(3-fluoro-[1,1'-biphenyl]-4-yl)boronic acid;B-(3-Fluoro[1,1'-biphenyl]-4-yl)boronic acid | | CAS: | 409108-13-0 | | MF: | C12H10BFO2 | | MW: | 216.02 | | EINECS: | | | Product Categories: | Boronic acid | | Mol File: | 409108-13-0.mol |  |
| | 3-Fluoro-4-biphenylboronic acid Chemical Properties |
| Melting point | 237-242°C | | storage temp. | Sealed in dry,2-8°C | | form | solid | | color | White | | InChI | InChI=1S/C12H10BFO2/c14-12-8-10(6-7-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,15-16H | | InChIKey | JUHFAPMMWMSLKH-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(C2=CC=CC=C2)C=C1F)(O)O | | CAS DataBase Reference | 409108-13-0 |
| | 3-Fluoro-4-biphenylboronic acid Usage And Synthesis |
| Chemical Properties | White powder |
| | 3-Fluoro-4-biphenylboronic acid Preparation Products And Raw materials |
|