|
|
| | 4''-Pentyl-3-fluorobiphenyl-4-boronic acid Basic information |
| Product Name: | 4''-Pentyl-3-fluorobiphenyl-4-boronic acid | | Synonyms: | (3-Fluoro-4'-pentyl[1,1'-biphenyl]-4-yl)boronic acid;(3-Fluoro-4'-pentyl-[1,1'-biphenyl]-4-yl);(3-Fluoro-4-Pentyl-4-Biphenylyl)Boronic Acid;3-fluoro-4'-pentylbiphenyl-4-ylboronic acid;Boronic acid, B-(3-fluoro-4'-pentyl[1,1'-biphenyl]-4-yl)-;[2-fluoro-4-(4-pentylphenyl)phenyl]boronic acid;(3-Fluoro-4'-Pentyl-4-Biphenylyl)Boronic Acid;(3-Fluoro-4'-pentyl-[1,1'-biphenyl]-4-yl)boronic acid | | CAS: | 163129-14-4 | | MF: | C17H20BFO2 | | MW: | 286.15 | | EINECS: | | | Product Categories: | | | Mol File: | 163129-14-4.mol |  |
| | 4''-Pentyl-3-fluorobiphenyl-4-boronic acid Chemical Properties |
| Boiling point | 436.1±55.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 8.40±0.58(Predicted) | | InChI | InChI=1S/C17H20BFO2/c1-2-3-4-5-13-6-8-14(9-7-13)15-10-11-16(18(20)21)17(19)12-15/h6-12,20-21H,2-5H2,1H3 | | InChIKey | CCBMYLLGXOKXFX-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(C2=CC=C(CCCCC)C=C2)C=C1F)(O)O |
| | 4''-Pentyl-3-fluorobiphenyl-4-boronic acid Usage And Synthesis |
| | 4''-Pentyl-3-fluorobiphenyl-4-boronic acid Preparation Products And Raw materials |
|