|
|
| | 3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole Basic information | | Applications |
| Product Name: | 3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole | | Synonyms: | TZA;3-(4-biphenyl)-4-phenyl-5-tert-butylphenyl-1,2,4-triazole/TAZ;3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole 97%;3-([1,1'-biphenyl]-4-yl)-5-(4-(tert-butyl)phenyl)-4-phenyl-4H-1,2,4-triazole;3-(4-tert-butylphenyl)-4-phenyl-5-(4-phenylphenyl)-1,2,4-triazole;3-(BIPHENYL-4-YL)-5-(4-TERT-BUTYLPHENYL)-4H-1,2,4-TRIAZOLE;3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole, 99.5%, purified by sublimation;3-(4-BIPHENYLYL)-4-PHENYL- | | CAS: | 150405-69-9 | | MF: | C30H27N3 | | MW: | 429.56 | | EINECS: | 623-896-0 | | Product Categories: | oled materials;OLED | | Mol File: | 150405-69-9.mol |  |
| | 3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole Chemical Properties |
| Melting point | 231-235 °C | | Boiling point | 611.5±58.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | pka | 1.78±0.10(Predicted) | | form | powder/crystals | | color | White | | InChI | 1S/C30H27N3/c1-30(2,3)26-20-18-25(19-21-26)29-32-31-28(33(29)27-12-8-5-9-13-27)24-16-14-23(15-17-24)22-10-6-4-7-11-22/h4-21H,1-3H3 | | InChIKey | ZVFQEOPUXVPSLB-UHFFFAOYSA-N | | SMILES | CC(C)(C)c1ccc(cc1)-c2cc(cc(c2)-c3nc[nH]n3)-c4ccc(cc4)-c5ccccc5 | | CAS DataBase Reference | 150405-69-9 | | Absorption | λmax 280 nmin chloroform |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole Usage And Synthesis |
| Applications | 1,2,4-triazole-based 3-(biphenyl-4-yl)-5-(4-tertbutylphenyl)-4-phenyl-4H-1,2,4-triazole (TAZ) (ET: 2.7 eV, HOMO/LUMO: 6.3/2.7 eV) has mostly been used in blue phosphorescent OLEDs (PhOLEDs) to serve as an efficient electron-transporting and hole-blocking layer due to its high triplet energy level that would confine the triplet excitons within the emissive layer.
The low HOMO/LUMO energy level of TAZ is beneficial for blocking holes and facilitating electron injection/transport, thereby enhancing the device performance.
| | Description | 1,2,4-triazole-based 3-(biphenyl-4-yl)-5-(4-tertbutylphenyl)-4-phenyl-4H-1,2,4-triazole(TAZ) (ET: 2.7 eV,HOMO/LUMO: 6.3/2.7 eV) has mostly been used in blue phosphorescent OLEDs (PhOLEDs) to serve as an efficient electron-transporting and hole-blocking layer due to its high triplet energy level that would confine the triplet excitons within the emissive layer. | | Uses | OLED and QD-LED electron transporter and hole blocker material. |
| | 3-(Biphenyl-4-yl)-5-(4-tert-butylphenyl)-4-phenyl-4H-1,2,4-triazole Preparation Products And Raw materials |
|