|
|
| | 1-Piperidinecarboxylic acid, 3-methyl-4-oxo-, 1,1-dimethylethyl ester, (3R)- Basic information |
| | 1-Piperidinecarboxylic acid, 3-methyl-4-oxo-, 1,1-dimethylethyl ester, (3R)- Chemical Properties |
| Boiling point | 298.8±33.0 °C(Predicted) | | density | 1.060±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | -1.54±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H19NO3/c1-8-7-12(6-5-9(8)13)10(14)15-11(2,3)4/h8H,5-7H2,1-4H3/t8-/m1/s1 | | InChIKey | VWSBNWIPICCWAM-MRVPVSSYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(=O)[C@H](C)C1 |
| | 1-Piperidinecarboxylic acid, 3-methyl-4-oxo-, 1,1-dimethylethyl ester, (3R)- Usage And Synthesis |
| Uses | tert-Butyl (3R)-3-methyl-4-oxo-piperidine-1-carboxylate is used in the process for preparation of intermediates for optically active piperidine derivatives. |
| | 1-Piperidinecarboxylic acid, 3-methyl-4-oxo-, 1,1-dimethylethyl ester, (3R)- Preparation Products And Raw materials |
|