| Company Name: |
Chemsky(shanghai)International Co.,Ltd.
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@163.com |
| Products Intro: |
Product Name:Atenolol-d7 CAS:1202864-50-3 Purity:98% Package:1620RMB/10mg; 4844RMB/50mg; 6500RMB/100mg
|
|
| | ATENOLOL-D7 Basic information |
| | ATENOLOL-D7 Chemical Properties |
| Melting point | 147-1490C | | storage temp. | Refrigerator | | solubility | Chloroform (Very Slightly, Heated, Sonicated), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C14H22N2O3/c1-10(2)16-8-12(17)9-19-13-5-3-11(4-6-13)7-14(15)18/h3-6,10,12,16-17H,7-9H2,1-2H3,(H2,15,18)/i1D3,2D3 | | InChIKey | METKIMKYRPQLGS-WFGJKAKNSA-N | | SMILES | N(C(C([2H])([2H])[2H])C([2H])([2H])[2H])CC(O)COc1ccc(cc1)CC(=O)N | | CAS DataBase Reference | 1202864-50-3 |
| WGK Germany | 2 | | RTECS | AC3600000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| | ATENOLOL-D7 Usage And Synthesis |
| Chemical Properties | Crystalline Solid | | Uses | Cardioselective β-adrenergic blocker. Antihypertensive, antianginal, antiarrhythmic (class II). | | Uses | Cardioselective adrenergic blocker. Antihypertensive, antianginal, antiarrhythmic (class II) |
| | ATENOLOL-D7 Preparation Products And Raw materials |
|