|
|
| | 2-[4-(3-Chloro-2-hydroxypropoxy)phenyl]acetamide Basic information |
| | 2-[4-(3-Chloro-2-hydroxypropoxy)phenyl]acetamide Chemical Properties |
| Melting point | 139 - 141°C | | Boiling point | 492.5±40.0 °C(Predicted) | | density | 1.287±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 13.11±0.20(Predicted) | | form | Solid | | color | White to Off-White | | InChI | 1S/C11H14ClNO3/c12-6-9(14)7-16-10-3-1-8(2-4-10)5-11(13)15/h1-4,9,14H,5-7H2,(H2,13,15) | | InChIKey | OQFMSHFNOSFLJU-UHFFFAOYSA-N | | SMILES | ClCC(O)COc1ccc(cc1)CC(=O)N |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-[4-(3-Chloro-2-hydroxypropoxy)phenyl]acetamide Usage And Synthesis |
| Uses | 4-(3-Chloro-2-hydroxypropoxy)benzeneacetamide is an impurity of Atenolol (A790075), a cardioselective β-adrenergic blocker. Atenolol EP Impurity D |
| | 2-[4-(3-Chloro-2-hydroxypropoxy)phenyl]acetamide Preparation Products And Raw materials |
|