| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Hydroxy-5-nitrophenyl sulfate dipotassium salt Basic information |
| | 2-Hydroxy-5-nitrophenyl sulfate dipotassium salt Chemical Properties |
| Melting point | >300°C | | storage temp. | -20°C | | solubility | H2O: 0.1 g/mL, clear | | form | crystalline | | color | yellow | | Water Solubility | Soluble in water (100 mg/ml). | | Sensitive | Light Sensitive | | BRN | 3805018 | | Stability: | Hygroscopic | | InChI | 1S/C6H5NO7S.2K/c8-5-2-1-4(7(9)10)3-6(5)14-15(11,12)13;;/h1-3,8H,(H,11,12,13);;/q;2*+1/p-2 | | InChIKey | CKWWBDCAYRJAJB-UHFFFAOYSA-L | | SMILES | [K+].[K+].[O-]c1ccc(cc1OS([O-])(=O)=O)[N+]([O-])=O | | CAS DataBase Reference | 14528-64-4(CAS DataBase Reference) |
| | 2-Hydroxy-5-nitrophenyl sulfate dipotassium salt Usage And Synthesis |
| Chemical Properties | yellow to orange crystalline powder | | Uses | 4-Nitrocatechol Sulfate Dipotassium Salt (cas# 14528-64-4) is a compound useful in organic synthesis. |
| | 2-Hydroxy-5-nitrophenyl sulfate dipotassium salt Preparation Products And Raw materials |
|