| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4'-Hydroxybiphenyl-3-carboxylic acid methyl ester Basic information |
| Product Name: | 4'-Hydroxybiphenyl-3-carboxylic acid methyl ester | | Synonyms: | METHYL 4'-HYDROXY-[1,1'-BIPHENYL]-3-CARBOXYLATE;METHYL 3-(4-HYDROXYPHENYL)BENZOATE;Methyl 4'-hydroxybiphenyl-3-carboxylate, 95%;AKOS BAR-0329;SALOR-INT L480215-1EA;4'-Hydroxy-3-(methoxycarbonyl)biphenyl, Methyl 3-(4-hydroxyphenyl)benzoate, 4-[3-(Methoxycarbonyl)phenyl]phenol;4-(3-Methoxycarbonylphenyl)phenol;1,1'-Biphenyl]-3-carboxylic acid, 4'-hydroxy-, methyl ester | | CAS: | 192376-76-4 | | MF: | C14H12O3 | | MW: | 228.24 | | EINECS: | | | Product Categories: | | | Mol File: | 192376-76-4.mol |  |
| | 4'-Hydroxybiphenyl-3-carboxylic acid methyl ester Chemical Properties |
| Melting point | 128-132 °C(lit.) | | Boiling point | 391.4±25.0 °C(Predicted) | | density | 1.194±0.06 g/cm3(Predicted) | | pka | 9.65±0.26(Predicted) | | form | solid | | InChI | 1S/C14H12O3/c1-17-14(16)12-4-2-3-11(9-12)10-5-7-13(15)8-6-10/h2-9,15H,1H3 | | InChIKey | ZWSVMMHYHQNTKA-UHFFFAOYSA-N | | SMILES | COC(=O)c1cccc(c1)-c2ccc(O)cc2 | | CAS DataBase Reference | 192376-76-4 |
| Hazard Codes | Xi,N | | Risk Statements | 37/38-41-50/53 | | Safety Statements | 26-36-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | HazardClass | 9 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 4'-Hydroxybiphenyl-3-carboxylic acid methyl ester Usage And Synthesis |
| Uses | Methyl 3-(4-Hydroxyphenyl)benzoate acts as a reagent in the synthesis of mannoside bacterial FimH antagonists with great potentials in the treatment of urinary tract infections. |
| | 4'-Hydroxybiphenyl-3-carboxylic acid methyl ester Preparation Products And Raw materials |
|