| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3'-Hydroxybiphenyl-4-carboxylic acid methyl ester Basic information |
| | 3'-Hydroxybiphenyl-4-carboxylic acid methyl ester Chemical Properties |
| Melting point | 153-157 °C (lit.) | | Boiling point | 404.8±38.0 °C(Predicted) | | density | 1.194±0.06 g/cm3(Predicted) | | pka | 9.55±0.10(Predicted) | | form | solid | | InChI | 1S/C14H12O3/c1-17-14(16)11-7-5-10(6-8-11)12-3-2-4-13(15)9-12/h2-9,15H,1H3 | | InChIKey | LIQIQAWUDHGWSL-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccc(cc1)-c2cccc(O)c2 |
| Hazard Codes | Xi,N | | Risk Statements | 37/38-41-50/53 | | Safety Statements | 26-36-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | HS Code | 2918290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 3'-Hydroxybiphenyl-4-carboxylic acid methyl ester Usage And Synthesis |
| | 3'-Hydroxybiphenyl-4-carboxylic acid methyl ester Preparation Products And Raw materials |
|