5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid manufacturers
|
| | 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid Basic information |
| Product Name: | 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid | | Synonyms: | 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid 97%;IFLAB-BB F2124-0564;5-Methyl-2-phenyloxazole-4-carboxylic acid;5-Methyl-2-phenyl-oxazol-4-carboxylicacid;4-Oxazolecarboxylic acid, 5-Methyl-2-phenyl-;4-Carboxy-5-methyl-2-phenyl-1,3-oxazole, (4-Carboxy-5-methyl-1,3-oxazol-2-yl)benzene;5-Methyl-2-phenyl-1,3-oxazole-4-carboxylicacid97%;5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid | | CAS: | 18735-74-5 | | MF: | C11H9NO3 | | MW: | 203.19 | | EINECS: | | | Product Categories: | Heterocycles series;Carboxylic Acids;Oxazoles, Isoxazoles & Benzoxazoles;Carboxylic Acids;Oxazoles, Isoxazoles & Benzoxazoles | | Mol File: | 18735-74-5.mol |  |
| | 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid Chemical Properties |
| Melting point | 182 °C | | Boiling point | 400.1±37.0 °C(Predicted) | | density | 1.273±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 3.03±0.32(Predicted) | | InChI | 1S/C11H9NO3/c1-7-9(11(13)14)12-10(15-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14) | | InChIKey | YABCPNYCFFUVNM-UHFFFAOYSA-N | | SMILES | Cc1oc(nc1C(O)=O)-c2ccccc2 | | CAS DataBase Reference | 18735-74-5 |
| WGK Germany | WGK 3 | | Hazard Note | Harmful | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid Usage And Synthesis |
| Uses | 2-Phenyl-5-methyloxazole-4-carboxylic Acid is a building block used to prepare oxazole transthyretin amyloidogenesis inhibitors. It is also used to synthesize inhibitors of HldE kinase as Gram-negative antivirulence drugs. |
| | 5-Methyl-2-phenyl-1,3-oxazole-4-carboxylic acid Preparation Products And Raw materials |
|