|
|
| | Boc-N-methyl-L-phenylalanine Basic information |
| | Boc-N-methyl-L-phenylalanine Chemical Properties |
| Melting point | 168-170 °C | | Boiling point | 405.0±34.0 °C(Predicted) | | density | 1.146±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.90±0.10(Predicted) | | color | White to Off-White | | BRN | 2386503 | | Major Application | peptide synthesis | | InChI | 1S/C15H21NO4/c1-15(2,3)20-14(19)16(4)12(13(17)18)10-11-8-6-5-7-9-11/h5-9,12H,10H2,1-4H3,(H,17,18)/t12-/m0/s1 | | InChIKey | AJGJINVEYVTDNH-LBPRGKRZSA-N | | SMILES | CN([C@@H](Cc1ccccc1)C(O)=O)C(=O)OC(C)(C)C | | CAS DataBase Reference | 37553-65-4(CAS DataBase Reference) |
| WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | Boc-N-methyl-L-phenylalanine Usage And Synthesis |
| Chemical Properties | Off-white solid | | Uses | N-BOC-N-Methyl-L-phenylalanine, is an amino acid building block used in peptide synthesis. With a growing peptide drug market the fast, reliable synthesis of peptides is of great importance. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-N-methyl-L-phenylalanine Preparation Products And Raw materials |
|