| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
11-Heneicosanol manufacturers
- 11-Heneicosanol
-
- $2.20
-
2026-08-25
- CAS:3381-26-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 50kg
- 11-HENEICOSANOL
-
- $1.00
-
2024-07-20
- CAS:3381-26-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| | 11-Heneicosanol Basic information |
| Product Name: | 11-Heneicosanol | | Synonyms: | 11-Henicosanol;Di-n-decyl carbinol;henicosan-11-ol;11-Hecosanol;11-Heneicosanol (9CI, ACI);1-didecamonol;11-Heneicosanol | | CAS: | 3381-26-8 | | MF: | C21H44O | | MW: | 312.57 | | EINECS: | 222-184-3 | | Product Categories: | | | Mol File: | 3381-26-8.mol |  |
| | 11-Heneicosanol Chemical Properties |
| Melting point | 71-72°C | | Boiling point | 370.3±10.0 °C(Predicted) | | density | 0.837±0.06 g/cm3(Predicted) | | pka | 15.23±0.20(Predicted) | | form | Solid | | color | White to off-white | | BRN | 1765841 | | InChI | InChI=1S/C21H44O/c1-3-5-7-9-11-13-15-17-19-21(22)20-18-16-14-12-10-8-6-4-2/h21-22H,3-20H2,1-2H3 | | InChIKey | BCNCKKYOXRHQGT-UHFFFAOYSA-N | | SMILES | CCCCCCCCCCC(O)CCCCCCCCCC | | LogP | 9.344 (est) | | CAS DataBase Reference | 3381-26-8 |
| Provider | Language |
|
ALFA
| English |
| | 11-Heneicosanol Usage And Synthesis |
| Uses | Henicosan-11-ol (11-Heneicosanol) is an ester product. |
| | 11-Heneicosanol Preparation Products And Raw materials |
|