| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:L-CCG-lll;(2S,1'S,2'R)-2-(Carboxycyclopropyl)glycine CAS:117857-95-1 Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
(2S,3R,4S)-CCG manufacturers
- L-CCG-lll
-
- $2380.00
-
2026-05-11
- CAS:117857-95-1
- Purity:
- Supply Ability: 10g
|
| | (2S,3R,4S)-CCG Basic information |
| Product Name: | (2S,3R,4S)-CCG | | Synonyms: | (2S,3S,4R)-CCG;(2S,3R,4S)-ALPHA-(CARBOXYCYCLOPROPYL)GLYCINE;(2S,3R,4S)-CCG;(2S,1'R,2'S)-2-(CARBOXYCYCLOPROPYL)GLYCINE;(2S,1'S,2'R)-2-(CARBOXYCYCLOPROPYL)GLYCINE;L-CCG-III;L-CCG-IV;(2S,1'R,2')-2-(2-carboxycyclopropyl)*glycine | | CAS: | 117857-95-1 | | MF: | C6H9NO4 | | MW: | 159.14 | | EINECS: | | | Product Categories: | Glutamate receptor | | Mol File: | 117857-95-1.mol |  |
| | (2S,3R,4S)-CCG Chemical Properties |
| Melting point | 190-193 °C (decomp) | | Boiling point | 414.1±20.0 °C(Predicted) | | density | 1.601±0.06 g/cm3(Predicted) | | storage temp. | Store at RT | | solubility | H2O: soluble | | form | solid | | pka | 2.40±0.10(Predicted) | | color | off-white | | Optical Rotation | [α]/D +69.5°, c = 0.4 in H2O(lit.) | | Water Solubility | H2O: soluble | | Major Application | peptide synthesis | | InChI | 1S/C6H9NO4/c7-4(6(10)11)2-1-3(2)5(8)9/h2-4H,1,7H2,(H,8,9)(H,10,11)/t2-,3+,4+/m1/s1 | | InChIKey | GZOVEPYOCJWRFC-UZBSEBFBSA-N | | SMILES | [H][C@]1(C[C@@H]1C(O)=O)[C@H](N)C(O)=O |
| WGK Germany | 3 | | HS Code | 2922500090 | | Storage Class | 11 - Combustible Solids |
| | (2S,3R,4S)-CCG Usage And Synthesis |
| Uses | L-CCG-IV is a potent small molecule agonist at the NMDA receptor. | | reaction suitability | reaction type: solution phase peptide synthesis | | Biological Activity | Potent and competitive inhibitor of both glial and neuronal uptake of glutamate, aspartate and cysteate. | | Biochem/physiol Actions | Potent NMDA receptor agonist. | | IC 50 | EAAT1; EAAT2 |
| | (2S,3R,4S)-CCG Preparation Products And Raw materials |
|