| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | L-Asparagine-amine-15N monohydrate Basic information |
| | L-Asparagine-amine-15N monohydrate Chemical Properties |
| Melting point | 233-235 °C (lit.) | | storage temp. | Store at -20°C | | form | Solid | | color | White to off-white | | Optical Rotation | [α]20/D +31.5°, c = 1 in 1 M HCl | | InChI | 1S/C4H8N2O3.H2O/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H2,6,7)(H,8,9);1H2/t2-;/m0./s1/i6+1; | | InChIKey | RBMGJIZCEWRQES-UEFLAVRISA-N | | SMILES | O.N[C@@H](CC([15NH2])=O)C(O)=O | | CAS Number Unlabeled | 5794-13-8 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Asparagine-amine-15N monohydrate Usage And Synthesis |
| Uses | L-Asparagine-amide-15N (monohydrate) is the 15N-labeled L-Asparagine (monohydrate). L-Asparagine monohydrate ((-)-Asparagine monohydrate) is a non-essential amino acid that is involved in the metabolic control of cell functions in nerve and brain tissue. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | L-Asparagine-amine-15N monohydrate Preparation Products And Raw materials |
|