| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)terbium(III) Basic information |
| Product Name: | Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)terbium(III) | | Synonyms: | TB(TMHD)3;TERBIUM TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATE);TERBIUM 2,2,6,6-TETRAMETHYL-3,5-HEPTANE-DIONATE;Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)terbium (III), (Tb(TMHD)3);TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)TERBIUM (III) 99% (99.9%-TB) (REO) [TB(TMHD)3];terbium(iii) tris(2,2,6,6-tetramethyl-3,5-heptanedionate);TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO)TERBIUM(III) (99.9%-TB) (REO) [TB(TMHD)3];Nsc174886 | | CAS: | 15492-51-0 | | MF: | C33H57O6Tb | | MW: | 708.73 | | EINECS: | | | Product Categories: | metal beta-diketonate complexes | | Mol File: | 15492-51-0.mol |  |
| | Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)terbium(III) Chemical Properties |
| Melting point | 163-164 °C(lit.) | | Boiling point | 275°C | | form | crystal | | color | off-white | | Sensitive | Hygroscopic | | InChI | 1S/3C11H20O2.Tb/c3*1-10(2,3)8(12)7-9(13)11(4,5)6;/h3*7,12H,1-6H3;/q;;;+3/p-3/b3*8-7-; | | InChIKey | JSAHJYGCYOFNGW-LWTKGLMZSA-K | | SMILES | CC(C)(C)C(=O)\C=C(/O[Tb](O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)C(C)(C)C | | CAS DataBase Reference | 15492-51-0 |
| WGK Germany | 3 | | TSCA | No | | Storage Class | 11 - Combustible Solids |
| | Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)terbium(III) Usage And Synthesis |
| reaction suitability | core: terbium
reagent type: catalyst |
| | Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)terbium(III) Preparation Products And Raw materials |
|