| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)aluminum Basic information |
| Product Name: | Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)aluminum | | Synonyms: | Aluminum, tris(2,2,6,6-tetramethyl-3,5-heptanedionato)-;Aluminum, tris(2,2,6,6-tetramethyl-3,5-heptanedionato-O,O')-, (OC-6-11)-;Aluminum, tris(2,2,6-tetramethyl-3,5-heptanedionato-O,O')-, (OC-6-)-;Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)aluminum(III);ALUMINUM TRIS(2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATE);ALUMINUM(III)2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONAT;ALUMINUM III 2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATE;AL(TMHD)3 | | CAS: | 14319-08-5 | | MF: | C33H57AlO6 | | MW: | 576.78 | | EINECS: | | | Product Categories: | metal beta-diketonate complexes | | Mol File: | 14319-08-5.mol |  |
| | Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)aluminum Chemical Properties |
| Melting point | 264-267 °C (lit.) | | Boiling point | >400°C | | Fp | >400°C | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | crystal | | color | white | | Sensitive | Hygroscopic | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | 1S/3C11H20O2.Al/c3*1-10(2,3)8(12)7-9(13)11(4,5)6;/h3*7,12H,1-6H3;/q;;;+3/p-3/b2*8-7+;8-7-; | | InChIKey | UREKUAIOJZNUGZ-GECNZSFWSA-K | | SMILES | CC(C)(C)C(=O)\C=C(\O[Al](O\C(=C\C(=O)C(C)(C)C)C(C)(C)C)O\C(=C/C(=O)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | TSCA | No | | Storage Class | 11 - Combustible Solids |
| | Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)aluminum Usage And Synthesis |
| reaction suitability | core: aluminum |
| | Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)aluminum Preparation Products And Raw materials |
|