|
|
| | Coproporphyrin I tetramethyl ester Basic information |
| Product Name: | Coproporphyrin I tetramethyl ester | | Synonyms: | TETRAMETHYL 3,8,13,18-TETRAMETHYL-21H,23H-PORPHINE-2,7,12,17-TETRAPROPIONATE;2,7,12,17-Porphinetetrapropionic acid, 3,8,13,18-tetramethyl-, tetramethyl ester;23h-porphine-2,7,12,17-tetrapropanoicacid,3,8,13,18-tetramethyl-21tetrame;Coproporphyrin tetramethyl ester i;CoproporphyrinItetramethylestersyntheticpurplextl;coproporphyrin I n-propyl ester;2,7,12,17-Tetramethyl-21H,23H-porphyrin-3,8,13,18-tetrakis(propanoic acid methyl) ester;2,7,12,17-Tetramethyl-21H,23H-porphyrin-3,8,13,18-tetrapropionic acid tetramethyl ester | | CAS: | 25767-20-8 | | MF: | C40H46N4O8 | | MW: | 710.82 | | EINECS: | 247-253-5 | | Product Categories: | Natural Porphyrins and Derivitives;Porphyrins;porphine (porphyrin) ligand | | Mol File: | 25767-20-8.mol |  |
| | Coproporphyrin I tetramethyl ester Chemical Properties |
| Melting point | 252-254 °C(lit.) | | Boiling point | 1058.9±65.0 °C(Predicted) | | density | 1.224±0.06 g/cm3(Predicted) | | storage temp. | Amber Vial, Refrigerator | | solubility | Chloroform, Dichloromethane, Tetrahydrofuran | | form | crystal | | color | purple | | ε(extinction coefficient) | 1,900-2,500 at 400nm in chloroform at 1% (actual value given on label) | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChIKey | OVYASYKFNWTMII-QEMHYRKZSA-N | | SMILES | COC(=O)CCc1c(C)c2cc3[nH]c(cc4nc(cc5[nH]c(cc1n2)c(C)c5CCC(=O)OC)c(C)c4CCC(=O)OC)c(C)c3CCC(=O)OC | | EPA Substance Registry System | 21H,23H-Porphine-2,7,12,17-tetrapropanoic acid, 3,8,13,18-tetramethyl-, tetramethyl ester (25767-20-8) |
| WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | Coproporphyrin I tetramethyl ester Usage And Synthesis |
| Chemical Properties | Purple-red Solid | | Uses | Coproporphyrin I Tetramethyl Ester is a methyl ester derivative of Coproporphyrin I (C685400). Coproporphyrin I Tetramethyl Ester is a nutritional requirement for the development of N. brasiliensis egg to third stage larvae. Coproporphyrin I Tetramethyl Ester is a tetrapyrrole compound excreted by Rhodobacter sphaeroides. Dyes and metabolites. |
| | Coproporphyrin I tetramethyl ester Preparation Products And Raw materials |
|