2-Mercapto-5-methylpyridine manufacturers
|
| | 2-Mercapto-5-methylpyridine Basic information |
| Product Name: | 2-Mercapto-5-methylpyridine | | Synonyms: | 5-METHYL-2(1H)-THIOPYRIDONE;2(1H)-Pyridinethione,5-methyl-(8CI,9CI);5-methyl-1H-pyridine-2-thione;5-Methyl-2-pyridinethiol;5-Methylpyridine-2(1H)-thione;2(1H)-Pyridinethione, 5-methyl-;2-Mercapto-5-methylpyridine | | CAS: | 18368-58-6 | | MF: | C6H7NS | | MW: | 125.19 | | EINECS: | | | Product Categories: | PYRIDINE | | Mol File: | 18368-58-6.mol |  |
| | 2-Mercapto-5-methylpyridine Chemical Properties |
| Boiling point | 195.1±23.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 9.79±0.40(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C6H7NS/c1-5-2-3-6(8)7-4-5/h2-4H,1H3,(H,7,8) | | InChIKey | IYKXPOCKTZADOH-UHFFFAOYSA-N | | SMILES | C1(=S)NC=C(C)C=C1 |
| | 2-Mercapto-5-methylpyridine Usage And Synthesis |
| Chemical Properties | Off-white powder |
| | 2-Mercapto-5-methylpyridine Preparation Products And Raw materials |
|