| Company Name: |
Chemwill Asia Co.,Ltd.
|
| Tel: |
86-21-51086038 |
| Email: |
chemwill_asia@126.com |
| Products Intro: |
CAS:2782-09-4 Purity:99% Package:5KG;1KG;25KG
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:D-Arabinono-1,4-lactone CAS:2782-09-4 Package:100Mg,1g
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58851090 13913916777 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
Product Name:D-Arabinono-1,4-lactone CAS:2782-09-4 Purity:95+% Package:1g;5g;10g
|
|
| | D-ARABINO-1,4-LACTONE Basic information |
| Product Name: | D-ARABINO-1,4-LACTONE | | Synonyms: | D-ARABINO-1,4-LACTONE;D-ARABONIC ACID-GAMMA-LACTONE;D-arabono-1,4-lactone;D-Arabinonic acid γ-lactone;1-Oxo-1-deoxy-D-arabinofuranose;D-Arabinoic acid 1,4-lactone;D-Arabinoic acid γ-lactone;D-arabinono-1,4-lactone | | CAS: | 2782-09-4 | | MF: | C5H8O5 | | MW: | 148.11 | | EINECS: | | | Product Categories: | Carbohydrates & Derivatives | | Mol File: | 2782-09-4.mol |  |
| | D-ARABINO-1,4-LACTONE Chemical Properties |
| Melting point | 113-114 °C(Solv: ethyl acetate (141-78-6)) | | Boiling point | 364.3±11.0 °C(Predicted) | | density | 1.667±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Methanol (Slightly), Water (Sparingly) | | pka | 12.10±0.60(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]/D 72.0±3.0°, c =1 in H2O | | Stability: | Hygroscopic | | InChI | 1S/C5H8O5/c6-1-2-3(7)4(8)5(9)10-2/h2-4,6-8H,1H2/t2-,3-,4+/m1/s1 | | InChIKey | CUOKHACJLGPRHD-JJYYJPOSSA-N | | SMILES | OC[C@H]1OC(=O)[C@@H](O)[C@@H]1O |
| WGK Germany | WGK 3 | | RTECS | CE6100000 | | Storage Class | 11 - Combustible Solids | | Toxicity | mouse,LD50,oral,10600mg/kg (10600mg/kg),Eisei Kagaku. Hygienic Chemistry. Vol. 12, Pg. 69, 1966. |
| | D-ARABINO-1,4-LACTONE Usage And Synthesis |
| Uses | D-Arabinono-1,4-lactone was used as a substrate for the analysis of L-Fucono-1,5-lactonase from cog3618 of amidohydrolase superfamily. | | Definition | ChEBI: D-arabinono-1,4-lactone is an arabinono-1,4-lactone. It has a role as a Saccharomyces cerevisiae metabolite. It is functionally related to a D-arabinonic acid. It is an enantiomer of a L-arabinono-1,4-lactone. |
| | D-ARABINO-1,4-LACTONE Preparation Products And Raw materials |
|