| Company Name: |
RYSS TECH LTD |
| Tel: |
400-188-0725 +86 21 34310725 13611771617 |
| Email: |
|
|
| | L-Galactono-1,4-lactone Basic information |
| Product Name: | L-Galactono-1,4-lactone | | Synonyms: | Galactonolactone;L(+)-GALACTONICACIDG-LACTONE;L-(+)-Galactonic acid γ-lactone;L-Galactono-1,4-lactone ,98%;L(+)-GALACTONIC ACID GAMMA-LACTONE;L-GALACTONIC ACID GAMMA LACTONE;L(+)-GALACTONO-1,4-LACTONE;GAMMA-L-GALACTONOLACTONE | | CAS: | 1668-08-2 | | MF: | C6H10O6 | | MW: | 178.14 | | EINECS: | | | Product Categories: | | | Mol File: | 1668-08-2.mol |  |
| | L-Galactono-1,4-lactone Chemical Properties |
| Melting point | 134-136 °C | | Boiling point | 467.9±18.0 °C(Predicted) | | density | 1.766±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 12.06±0.60(Predicted) | | form | solid | | color | white | | Optical Rotation | [α]/D 78.0±3.0°, c = 1 in H2O | | BRN | 83005 | | Cosmetics Ingredients Functions | HUMECTANT | | Cosmetic Ingredient Review (CIR) | L-GALACTONO-1,4-LACTONE (1668-08-2) | | InChI | 1S/C6H10O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-5,7-10H,1H2/t2-,3-,4-,5+/m0/s1 | | InChIKey | SXZYCXMUPBBULW-NEEWWZBLSA-N | | SMILES | OC[C@H](O)[C@H]1OC(=O)[C@@H](O)[C@@H]1O || OC[C@H](O)[C@H]1OC(=O)[C@@H](O)[C@@H]1O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29322090 | | Storage Class | 11 - Combustible Solids |
| | L-Galactono-1,4-lactone Usage And Synthesis |
| Chemical Properties | White powder | | Uses | L-Galactono-1,4-lactone is used as a substrate for the investigation of an L-Fucono-1,5-lactonase from cog3618 of amidohydrolase superfamily. | | Definition | ChEBI: L-galactono-1,4-lactone is a galactonolactone that is 3,4-dihydroxydihydrofuran-2(3H)-one substituted by a 1,2-dihydroxyethyl group at position 5 (the 3S,4S,5R-isomer). It has a role as a plant metabolite. It is functionally related to a L-galactonic acid. | | Biological Activity | Metabolite in the biosynthetic pathway of vitamin C in higher plants. | | IC 50 | Human Endogenous Metabolite |
| | L-Galactono-1,4-lactone Preparation Products And Raw materials |
|