1-Thio-beta-D-glucose sodium salt manufacturers
|
| | 1-Thio-beta-D-glucose sodium salt Basic information |
| | 1-Thio-beta-D-glucose sodium salt Chemical Properties |
| Melting point | 173°C | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Water (Slightly), Methanol (Very Slightly, Heated, Sonicated) | | form | Powder | | color | White to Off-white | | Water Solubility | Soluble in water | | InChI | 1S/C6H12O5S.Na.H/c7-1-2-3(8)4(9)5(10)6(12)11-2;;/h2-10,12H,1H2;; | | InChIKey | BJZCRDSEUWQHLR-UHFFFAOYSA-N | | SMILES | O[C@@H]1[C@@H](CO)O[C@@H](S[Na])[C@H](O)[C@H]1O | | CAS DataBase Reference | 10593-29-0 |
| Safety Statements | 6-24/25 | | WGK Germany | 3 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | 1-Thio-beta-D-glucose sodium salt Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | beta-D-Thioglucose sodium salt, is used in research and to treat rheumatoid arthritis. The biological mechanism is unknown. 1-Thio-β is often used as a carrier molecule for cell uptake of markers, polymers, and nanoparticles, and potentially useful synthetic reagent. |
| | 1-Thio-beta-D-glucose sodium salt Preparation Products And Raw materials |
|