| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Chenodeoxycholic Acid-d4 CAS:99102-69-9 Package:50Mg,5Mg
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Chenodeoxycholic-d4 Acid CAS:99102-69-9 Remarks:CS-C-01374
|
CHENODEOXYCHOLIC-2,2,4,4-D4 ACID manufacturers
|
| | CHENODEOXYCHOLIC-2,2,4,4-D4 ACID Basic information |
| | CHENODEOXYCHOLIC-2,2,4,4-D4 ACID Chemical Properties |
| Melting point | 165-167 °C(lit.) | | Fp | 9℃ | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | form | Solid | | color | White to Off-White | | InChIKey | RUDATBOHQWOJDD-PSTGXAJBSA-N | | SMILES | O[C@H]1[C@@H]2[C@@H]([C@@]4([C@@H](C([C@@H](C(C4)([2H])[2H])O)([2H])[2H])C1)C)CC[C@]3([C@H]2CC[C@@H]3[C@@H](CCC(=O)O)C)C | | CAS Number Unlabeled | 474-25-9 |
| Safety Statements | 22-24/25 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 3 | | RTECS | FZ1980000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| | CHENODEOXYCHOLIC-2,2,4,4-D4 ACID Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Labelled Chenodiol (Chenodeoxycholic acid). A major bile acid in many vertebrates, occurring as the N-glycine and/or N-taurine conjugate. With other bile acids, forms mixed micelles with lecithin in bile which solubilize cholesterol and thus facilitates its excretion. Fcilitates fat absorption in the small intestine by micellar solubilization of fatty acids and monoglycerides. Anticholelithogenic. Epimeric with Ursodiol. |
| | CHENODEOXYCHOLIC-2,2,4,4-D4 ACID Preparation Products And Raw materials |
|