| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
CHENODEOXYCHOLIC-2,2,4,4-D4 ACID manufacturers
|
| | CHENODEOXYCHOLIC-2,2,4,4-D4 ACID Basic information |
| Product Name: | CHENODEOXYCHOLIC-2,2,4,4-D4 ACID | | Synonyms: | (+)-Chenodeoxycholic Acid-d4;(3α,5β,7α)-3,7-Dihydroxycholan-24-oic Acid-d4;17β-(1-Methyl-3-carboxypropyl)etiocholane-3α,7α-diol-d4;CDC-d4;Chendol-d4;Chenocol-d4;Fluibil-d4;CHENODEOXYCHOLIC-2,2,4,4-D4 ACID | | CAS: | 99102-69-9 | | MF: | C24H36D4O4 | | MW: | 396.6 | | EINECS: | | | Product Categories: | Bile Acids - 13C & 2H;Alphabetical Listings;CStable Isotopes;Labeled Bioactive Compounds;Stable Isotopes;Steroids;Intermediates & Fine Chemicals;Isotope Labelled Compounds;Pharmaceuticals | | Mol File: | 99102-69-9.mol |  |
| | CHENODEOXYCHOLIC-2,2,4,4-D4 ACID Chemical Properties |
| Melting point | 165-167 °C(lit.) | | Boiling point | 547.148±25.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.129±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Fp | 9℃ | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | form | Solid | | pka | 4.758±0.10(predicted) | | color | White to Off-White | | InChIKey | RUDATBOHQWOJDD-PSTGXAJBSA-N | | SMILES | O[C@H]1[C@@H]2[C@@H]([C@@]4([C@@H](C([C@@H](C(C4)([2H])[2H])O)([2H])[2H])C1)C)CC[C@]3([C@H]2CC[C@@H]3[C@@H](CCC(=O)O)C)C | | CAS Number Unlabeled | 474-25-9 |
| Safety Statements | 22-24/25 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 3 | | RTECS | FZ1980000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | CHENODEOXYCHOLIC-2,2,4,4-D4 ACID Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Labelled Chenodiol (Chenodeoxycholic acid). A major bile acid in many vertebrates, occurring as the N-glycine and/or N-taurine conjugate. With other bile acids, forms mixed micelles with lecithin in bile which solubilize cholesterol and thus facilitates its excretion. Fcilitates fat absorption in the small intestine by micellar solubilization of fatty acids and monoglycerides. Anticholelithogenic. Epimeric with Ursodiol. |
| | CHENODEOXYCHOLIC-2,2,4,4-D4 ACID Preparation Products And Raw materials |
|