| Company Name: |
Hu Bei Jiutian Bio-medical Technology CO.,Ltd |
| Tel: |
027-88013699 17354350817 |
| Email: |
Ryan@jiutian-bio.com |
| Products Intro: |
Product Name:2-Propen-1-ol,3-phenyl-, 1-propanoate, (2E)- CAS:78761-38-3 Purity:0.99 Package:25kg,50kg,180kg,200kg,250kg,1000kg,as your needs Remarks:as your needs
|
|
|
|
|
CINNAMYL PROPIONATE manufacturers
- CINNAMYL PROPIONATE
-
- $0.00 / 1kg
-
2024-07-22
- CAS:78761-38-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 10ton
|
| | CINNAMYL PROPIONATE Basic information |
| | CINNAMYL PROPIONATE Chemical Properties |
| Boiling point | 289 °C (lit.) | | density | 1.032 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.535(lit.) | | Fp | >230 °F | | Odor | at 100.00 %. fruity balsam grape | | Odor Type | fruity | | biological source | synthetic | | Major Application | flavors and fragrances | | InChI | 1S/C12H14O2/c1-2-12(13)14-10-6-9-11-7-4-3-5-8-11/h3-9H,2,10H2,1H3/b9-6+ | | InChIKey | KGDJMNKPBUNHGY-RMKNXTFCSA-N | | SMILES | [H]\C(COC(=O)CC)=C(\[H])c1ccccc1 | | LogP | 3.150 (est) |
| WGK Germany | 2 | | RTECS | GE2360000 | | Storage Class | 10 - Combustible liquids |
| | CINNAMYL PROPIONATE Usage And Synthesis |
| Uses | flavors and fragrances | | General Description | trans-Cinnamyl propionate is a flavor compound that occurs naturally in cinnamon. |
| | CINNAMYL PROPIONATE Preparation Products And Raw materials |
|