|
|
| | BROMOCLENBUTEROL Basic information |
| Product Name: | BROMOCLENBUTEROL | | Synonyms: | BROMOCLENBUTEROL;Clenbuterol Impurity 6（Clenbuterol EP Impurity F）;lenbuterol EP Impurity F;1-(4-amino-3-bromo-5-chlorophenyl)-2-(tert-butylamino)ethanol;Clenbuterol EP Impurity F;Benzenemethanol, 4-amino-3-bromo-5-chloro-α-[[(1,1-dimethylethyl)amino]methyl]-;1-(4-amino-3-bromo-5-chlorophenyl)-2-(tert-butylamino)ethan-1-ol;(1RS)-1-(4-Amino-3-bromo-5-chlorophenyl)-2-[(1,1-dimethylethyl)amino]ethanol | | CAS: | 37153-52-9 | | MF: | C12H18BrClN2O | | MW: | 321.64 | | EINECS: | | | Product Categories: | | | Mol File: | 37153-52-9.mol |  |
| | BROMOCLENBUTEROL Chemical Properties |
| Boiling point | 430.3±40.0 °C(Predicted) | | density | 1.424±0.06 g/cm3(Predicted) | | pka | 13.48±0.20(Predicted) | | InChI | InChI=1S/C12H18BrClN2O/c1-12(2,3)16-6-10(17)7-4-8(13)11(15)9(14)5-7/h4-5,10,16-17H,6,15H2,1-3H3 | | InChIKey | RBROAKIHDILEQG-UHFFFAOYSA-N | | SMILES | C1(N)C(Br)=CC(=CC=1Cl)C(O)CNC(C)(C)C |
| | BROMOCLENBUTEROL Usage And Synthesis |
| Uses | Bromoclenbuterol is a β-agonist in human urine. |
| | BROMOCLENBUTEROL Preparation Products And Raw materials |
|