| Company Name: |
Qi-Chem Co., Ltd. Gold |
| Tel: |
0411-88165951 13601035838 |
| Email: |
marketing@qi-chem.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-CHLORO-4-FLUORO-5-NITROBENZOIC ACID Basic information |
| | 2-CHLORO-4-FLUORO-5-NITROBENZOIC ACID Chemical Properties |
| Melting point | 146-150 | | Boiling point | 364.2±42.0 °C(Predicted) | | density | 1.689±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in methanol. | | pka | 2.32±0.12(Predicted) | | form | Powder | | color | White | | InChI | InChI=1S/C7H3ClFNO4/c8-4-2-5(9)6(10(13)14)1-3(4)7(11)12/h1-2H,(H,11,12) | | InChIKey | SYZKAFCPWNFONG-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=C(F)C=C1Cl | | CAS DataBase Reference | 114776-15-7 |
| Hazard Codes | Xi | | Hazard Note | Irritant/Keep Cold | | HS Code | 2916399090 |
| | 2-CHLORO-4-FLUORO-5-NITROBENZOIC ACID Usage And Synthesis |
| Uses | 2-Chloro-4-fluoro-5-nitrobenzoic acid is used as pharmaceutical intermediate. | | Synthesis | The general procedure for the synthesis of 2-chloro-4-fluoro-5-nitrobenzoic acid from 2-chloro-4-fluorobenzoic acid was as follows: 50 g of concentrated sulfuric acid and 0.8 g of the catalyst prepared in Example 1 were added to a reaction flask, followed by the addition of 10 g of 2-chloro-4-fluorobenzoic acid in batches. The reaction mixture was stirred at 25°C for 1 hour. The reaction mixture was cooled to 0°C in an ice bath, and then 5 g of fuming nitric acid was added slowly and dropwise, controlling the reaction temperature between -5 and 8°C. The reaction was continued for 5 to 8 hours until the content of 2-chloro-4-fluorobenzoic acid was less than 0.5%. The reaction mixture was slowly poured into 80 g of crushed ice and the solid product was collected by filtration. The filter cake was washed with 30 g of ice water and subsequently air-dried at 65 °C to give 12.0 g of the white solid product 2-chloro-4-fluoro-5-nitrobenzoic acid in 97.1% yield and 97.2% purity. The isomer of formula (II) was 1.1% by weight. | | References | [1] Patent: CN106866684, 2017, A. Location in patent: Paragraph 0131-0132; 0204-0205 [2] Patent: CN106905161, 2017, A. Location in patent: Paragraph 0014; 0015; 0016; 0017 [3] Farmaco, 2004, vol. 59, # 6, p. 463 - 471 [4] Synthesis, 1987, # 10, p. 883 - 887 [5] Patent: US2002/45550, 2002, A1 |
| | 2-CHLORO-4-FLUORO-5-NITROBENZOIC ACID Preparation Products And Raw materials |
|