|
|
| | 5-AMino-2-chloro-4-fluoro-benzoic acid Methyl ester Basic information |
| Product Name: | 5-AMino-2-chloro-4-fluoro-benzoic acid Methyl ester | | Synonyms: | 5-AMino-2-chloro-4-fluoro-benzoic acid Methyl ester;Methyl 5-aMino-2-chloro-4-fluorobenzoate;Benzoic acid, 5-amino-2-chloro-4-fluoro-, methyl ester;Methyl 2-chloro-4-fluoro-5-aminobenzoate;2-fluoro-4-chloro-5-methoxycarbonylaniline; 5-AMino-2-chloro-4-fluoro-benzoic acid Methyl | | CAS: | 141772-31-8 | | MF: | C8H7ClFNO2 | | MW: | 203.6 | | EINECS: | | | Product Categories: | | | Mol File: | 141772-31-8.mol |  |
| | 5-AMino-2-chloro-4-fluoro-benzoic acid Methyl ester Chemical Properties |
| storage temp. | 2-8°C, protect from light | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C8H7ClFNO2/c1-13-8(12)4-2-7(11)6(10)3-5(4)9/h2-3H,11H2,1H3 | | InChIKey | GRQLIRSFYJTUQR-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(N)=C(F)C=C1Cl |
| | 5-AMino-2-chloro-4-fluoro-benzoic acid Methyl ester Usage And Synthesis |
| Uses | Methyl 5-Amino-2-chloro-4-fluorobenzoate is an intermediate of Saflufenacil (S081800), a herbicide of the pyrimidinedione chemical class used for the preplant burndown and selective preemergence dicot weed control in different field crops. |
| | 5-AMino-2-chloro-4-fluoro-benzoic acid Methyl ester Preparation Products And Raw materials |
|