H-Ile-Gly-OH manufacturers
- H-ILE-GLY-OH
-
- $1.00
-
2020-03-06
- CAS:868-28-0
- Min. Order: 1g
- Purity: ≥98%
|
| | H-Ile-Gly-OH Basic information |
| Product Name: | H-Ile-Gly-OH | | Synonyms: | L-ISOLEUCYL-GLYCINE;Ile-Gly-OH;L-Ile-Gly-OH;N-L-Isoleucylglycine;Ile-Gly-OH≥ 99% (Assay by Titration);2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]acetic acid;2-[(2S,3S)-2-amino-3-methylpentanamido]acetic acid;Glycine, L-isoleucyl- | | CAS: | 868-28-0 | | MF: | C8H16N2O3 | | MW: | 188.22 | | EINECS: | | | Product Categories: | | | Mol File: | 868-28-0.mol |  |
| | H-Ile-Gly-OH Chemical Properties |
| Melting point | 220 °C | | Boiling point | 410.4±30.0 °C(Predicted) | | density | 1.136±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | pka | 3.14±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C8H16N2O3/c1-3-5(2)7(9)8(13)10-4-6(11)12/h5,7H,3-4,9H2,1-2H3,(H,10,13)(H,11,12)/t5-,7-/m0/s1 | | InChIKey | UCGDDTHMMVWVMV-FSPLSTOPSA-N | | SMILES | C(O)(=O)CNC(=O)[C@H]([C@@H](C)CC)N |
| | H-Ile-Gly-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | H-ILE-GLY-OH is used for masking unpleasant tastes of Amino Acids and peptides. | | Definition | ChEBI: Ile-Gly is a dipeptide formed from L-isoleucine and glycine residues. It has a role as a metabolite. It is a tautomer of an Ile-Gly zwitterion. |
| | H-Ile-Gly-OH Preparation Products And Raw materials |
|