|
|
| | Z-Ile-Ile-OH Basic information |
| Product Name: | Z-Ile-Ile-OH | | Synonyms: | Z-L-ISOLEUCYL-L-ISOLEUCINE;N-[N-[(benzyloxy)carbonyl]-L-isoleucyl]-L-isoleucine;Cbz-Ile-Ile-OH;(2S,3S)-2-((2S,3S)-2-(((Benzyloxy)carbonyl)amino)-3-methylpentanamido)-3-methylpentanoic acid;Cbz-L-Ile-L-Ile-OH;-2-((2S,3S);-3-methylpentanamido);z-ile-ile | | CAS: | 42538-01-2 | | MF: | C20H30N2O5 | | MW: | 378.46 | | EINECS: | 255-876-9 | | Product Categories: | Dipeptides;Dipeptides and Tripeptides;Peptides | | Mol File: | 42538-01-2.mol |  |
| | Z-Ile-Ile-OH Chemical Properties |
| Melting point | 123 - 124°C | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChIKey | QJJULDSUCQXEDB-DRRRZMAASA-N | | SMILES | CC[C@H](C)[C@@H](C(N[C@@H]([C@@H](C)CC)C(O)=O)=O)NC(OCC1=CC=CC=C1)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Z-Ile-Ile-OH Usage And Synthesis |
| Uses | N-CBZ-Ile-Ile (Z-Ile-Ile) (CBZ-isoleucylisoleucine) is an N-terminal protected Cbz-dipeptide substrate used to differentiate, characterize and kinetically analyze various carboxypeptidase(s). |
| | Z-Ile-Ile-OH Preparation Products And Raw materials |
|