| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Ethyl viologen diperchlorate Basic information |
| Product Name: | Ethyl viologen diperchlorate | | Synonyms: | 1,1'-DIETHYL-4,4'-BIPYRIDINIUM DIPERCHLORATE;ethylene viologen diperchlorate;4,4'-BipyridiniuM, 1,1'-diethyl-, perchlorate (1:2);1,1'-Diethyl-[4,4'-bipyridine]-1,1'-diium perchlorate;ETHYL VIOLOGEN DIPERCHLORATE ISO 9001：2015 REACH;Ethyl viologen diperchlorate | | CAS: | 36305-51-8 | | MF: | C14H18Cl2N2O8 | | MW: | 413.21 | | EINECS: | | | Product Categories: | | | Mol File: | 36305-51-8.mol |  |
| | Ethyl viologen diperchlorate Chemical Properties |
| Melting point | 270 °C (dec.)(lit.) | | storage temp. | room temp | | solubility | H2O: 2.5% | | form | solid | | Appearance | White to off-white Solid | | Water Solubility | H2O: 2.5% | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | InChI=1S/C14H18N2.2ClHO4/c1-3-15-9-5-13(6-10-15)14-7-11-16(4-2)12-8-14;2*2-1(3,4)5/h5-12H,3-4H2,1-2H3;2*(H,2,3,4,5)/q+2;;/p-2 | | InChIKey | ISLQYGQZXKRRAB-UHFFFAOYSA-L | | SMILES | C1(C=C[N+](CC)=CC=1)C1=CC=[N+](CC)C=C1.Cl([O-])(=O)(=O)=O.Cl([O-])(=O)(=O)=O |
| Hazard Codes | Xi,Xn | | Risk Statements | 20/21/22 | | Safety Statements | 26-27-36-36/39 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | Ethyl viologen diperchlorate Usage And Synthesis |
| Chemical Properties | Solid | | Uses | Ethyl viologen diperchlorate has been used in in-situ spectroscopic studies of viologen based electrochromic device. |
| | Ethyl viologen diperchlorate Preparation Products And Raw materials |
|