|
|
| | Ethyl (R)-2-hydroxy-4-phenylbutyrate Basic information |
| | Ethyl (R)-2-hydroxy-4-phenylbutyrate Chemical Properties |
| Melting point | NA | | alpha | -10 º (c=neat) | | Boiling point | 212 °C(lit.) | | density | 1.075 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.504(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 13.00±0.20(Predicted) | | form | Liquid | | color | Colorless | | Optical Rotation | [α]21/D 10°, neat | | Water Solubility | insoluble | | BRN | 3590943 | | InChI | 1S/C12H16O3/c1-2-15-12(14)11(13)9-8-10-6-4-3-5-7-10/h3-7,11,13H,2,8-9H2,1H3/t11-/m1/s1 | | InChIKey | ZJYKSSGYDPNKQS-LLVKDONJSA-N | | SMILES | CCOC(=O)[C@H](O)CCc1ccccc1 | | CAS DataBase Reference | 90315-82-5(CAS DataBase Reference) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | HS Code | 29181990 | | Storage Class | 10 - Combustible liquids |
| | Ethyl (R)-2-hydroxy-4-phenylbutyrate Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | Ethyl(R)-2-hydroxy-4-phenylbutyrate is used in the preparation of benzothiophenes, benzofurans, and indoles useful in the treatment of insulin resistance and hyperglycemia. | | Uses | Ethyl (R)-(?)-2-hydroxy-4-phenylbutyrate can be used as a key intermediate for the synthesis of various ACE inhibitors like Cilazapril, Benazepril, and Enalapril. |
| | Ethyl (R)-2-hydroxy-4-phenylbutyrate Preparation Products And Raw materials |
|