| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Neryl isobutyrate
CAS:2345-24-6
Purity:>=97%, stabilized, FG Package:SAMPLE Remarks:W277509-SAMPLE-K
|
|
| | NERYL ISOBUTYRATE Basic information |
| Product Name: | NERYL ISOBUTYRATE | | Synonyms: | NERYL ISOBUTYRATE;(z)-2-methylpropanoicacid3,7-dimethyl-2,6-octadienylester;2-methyl-,3,7-dimethyl-2,6-octadienylester,(z)-propanoicaci;2-methyl-,3,7-dimethyl-2,6-octadienylester,(Z)-Propanoicacid;3,7-dimethyl-2,6-octadienylester,(z)-isobutyricaci;cis-3,7-dimethyl-2,6-octadien-1-ylisobutyrate;NERY ISO BUTYRATE;NERYL ISOBUTYRATE 97+% | | CAS: | 2345-24-6 | | MF: | C14H24O2 | | MW: | 224.34 | | EINECS: | 219-061-1 | | Product Categories: | Alphabetical Listings;Flavors and Fragrances;M-N | | Mol File: | 2345-24-6.mol |  |
| | NERYL ISOBUTYRATE Chemical Properties |
| Boiling point | 229 °C (lit.) | | density | 0.895 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.457(lit.) | | FEMA | 2775 | NERYL ISOBUTYRATE | | Fp | >230 °F | | solubility | Practically insoluble in water, soluble in alcohol and oils. | | form | liquid | | Specific Gravity | 0.94 | | color | Colorless | | Odor | at 100.00 %. sweet fresh fruity raspberry strawberry green | | Odor Type | fruity | | biological source | synthetic | | JECFA Number | 73 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C14H24O2/c1-11(2)7-6-8-13(5)9-10-16-14(15)12(3)4/h7,9,12H,6,8,10H2,1-5H3/b13-9- | | InChIKey | OGJYXQFXLSCKTP-LCYFTJDESA-N | | SMILES | CC(C)C(=O)OC\C=C(\C)CC\C=C(/C)C | | LogP | 4.98 | | EPA Substance Registry System | Propanoic acid, 2-methyl-, (2Z)-3,7-dimethyl-2,6-octadienyl ester (2345-24-6) |
| WGK Germany | 2 | | RTECS | UA2468500 | | TSCA | TSCA listed | | Storage Class | 12 - Non Combustible Liquids |
| | NERYL ISOBUTYRATE Usage And Synthesis |
| Description | Neryl isobutyrate has a delicate, sweet, rose-like fragrance with a slightly fruity undertone and a sweet, strawberry taste. May be prepared by esterification of nerol using isobutyric acid or the anhydride. | | Chemical Properties | Neryl isobutyrate has a delicate, sweet, rose-like fragrance with a slightly fruity undertone. It has a sweet, strawberry
taste | | Occurrence | Reported found in kumquat peel oil, hop oil, black tea and passion fruit. | | Uses | Neryl isobutyrate finds limited use in fragrance compositions where it may lend richness
(“body”) and deep sweetness to Citrus or
light floral bases, Rose and novelty types. As
a vanant in Honeysuckle, Gardenia, etc. It is used in flavor compositions for sweetness in Citrus flavors and
fruit complexes. | | Preparation | By esterification of nerol using isobutyric acid or the anhydride | | Definition | ChEBI: Geranyl 2-methylpropanoate is a carboxylic ester. | | Taste threshold values | Taste characteristics at 15 ppm: juicy and fruity, green, sweet, melon and waxy | | General Description | Neryl isobutyrate has been reported in the essential oils of plants such as Artemisia absinthiumL. and Telekia speciosa(Schreb.) Baumg. |
| | NERYL ISOBUTYRATE Preparation Products And Raw materials |
|