Phenanthro[3,4-d]oxazole, 10-chloro-2-phenyl- manufacturers
|
| | Phenanthro[3,4-d]oxazole, 10-chloro-2-phenyl- Basic information |
| | Phenanthro[3,4-d]oxazole, 10-chloro-2-phenyl- Chemical Properties |
| Boiling point | 513.1±23.0 °C(Predicted) | | density | 1.345±0.06 g/cm3(Predicted) | | pka | -0.21±0.30(Predicted) | | InChI | InChI=1S/C21H12ClNO/c22-16-10-8-13-6-7-14-9-11-18-20(19(14)17(13)12-16)24-21(23-18)15-4-2-1-3-5-15/h1-12H | | InChIKey | OVSSHXQZHDRKMG-UHFFFAOYSA-N | | SMILES | O1C2=C3C(=CC=C2N=C1C1=CC=CC=C1)C=CC1C3=CC(Cl)=CC=1 |
| | Phenanthro[3,4-d]oxazole, 10-chloro-2-phenyl- Usage And Synthesis |
| Uses | Phenanthro[3,4-d]oxazole, 10-chloro-2-phenyl- can be used as an intermediate in organic light-emitting materials, specifically for the research and development and production of organic light-emitting diodes (OLEDs). |
| | Phenanthro[3,4-d]oxazole, 10-chloro-2-phenyl- Preparation Products And Raw materials |
|