|
|
| | 6-Bromo-6'-chloro-[3,3']-bipyridine Basic information |
| Product Name: | 6-Bromo-6'-chloro-[3,3']-bipyridine | | Synonyms: | 2-Chloro-2'-bromo-[3,3']bipyridine;3,3'-Bipyridine, 6-bromo-6'-chloro-;6-Bromo-6'-chloro-3,3'-bipyridine;6-Bromo-6′-chloro-3,3′-bipyridine, CAS 942206-04-4;6-Bromo-6'-chloro-[3,3']-bipyridine | | CAS: | 942206-04-4 | | MF: | C10H6BrClN2 | | MW: | 269.52 | | EINECS: | | | Product Categories: | | | Mol File: | 942206-04-4.mol | ![6-Bromo-6'-chloro-[3,3']-bipyridine Structure](CAS/GIF/942206-04-4.gif) |
| | 6-Bromo-6'-chloro-[3,3']-bipyridine Chemical Properties |
| Melting point | >250 °C | | Boiling point | 389.2±37.0 °C(Predicted) | | density | 1.591±0.06 g/cm3(Predicted) | | pka | -1.11±0.12(Predicted) | | form | solid | | InChI | 1S/C10H6BrClN2/c11-9-3-1-7(5-13-9)8-2-4-10(12)14-6-8/h1-6H | | InChIKey | VHZRDSCPWVOYIE-UHFFFAOYSA-N | | SMILES | BrC1=NC=C(C2=CC=C(Cl)N=C2)C=C1 |
| Risk Statements | 41 | | Safety Statements | 26-39 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |
| | 6-Bromo-6'-chloro-[3,3']-bipyridine Usage And Synthesis |
| | 6-Bromo-6'-chloro-[3,3']-bipyridine Preparation Products And Raw materials |
|