| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
(S,R,S)-AHPC-PEG6-Azide manufacturers
|
| | (S,R,S)-AHPC-PEG6-Azide Basic information |
| Product Name: | (S,R,S)-AHPC-PEG6-Azide | | Synonyms: | (S,R,S)-AHPC-PEG6-Azide;(2S,4R)-1-((S)-23-Azido-2-(tert-butyl)-4-oxo-6,9,12,15,18,21-hexaoxa-3-azatricosanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide;(2S,4R)-1-((S)-23-Azido-2-(tert-butyl)-4-oxo-6,9,12,15,18,21-hexaoxa-3-azatricosanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide, Crosslinker-E3 ligase ligand conjugate, Protein degrader building block for PROTAC? research, Template for synthesis of targeted protein degrader, VH032 conjugate;(2S,4R)-1-((S)-23-azido-2-tert-butyl-4-oxo-6,9,12,15,18,21-hexaoxa-3-azatricosane)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide;(2S,4R)-1-[(2S)-2-(20-azido-3,6,9,12,15,18-hexaoxaicosanamido)-3,3-dimethylbutanoyl]-4-hydroxy-N-{[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl}pyrrolidine-2-carboxamide;(S,R,S)-AHPC-PEG6-Azide;(2S,4R)-1-((S)-23-Azido-2-(tert-butyl)-4-oxo-6,9,12,15,18,21-hexaoxa-3-azatricosanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide - [A89154] | | CAS: | 2086298-71-5 | | MF: | C36H55N7O10S | | MW: | 777.94 | | EINECS: | | | Product Categories: | | | Mol File: | 2086298-71-5.mol |  |
| | (S,R,S)-AHPC-PEG6-Azide Chemical Properties |
| storage temp. | 2-8°C | | form | (Liquid or Semi-Solid or Paste or Solid) | | Appearance | Light yellow to yellow Viscous Liquid | | InChIKey | AJSBEOXYBAZQFR-YLJHYDRVSA-N | | SMILES | O=C(COCCOCCOCCOCCOCCOCCN=[N+]=[N-])N[C@H](C(N1[C@H](C(NCC2=CC=C(C3=C(C)N=CS3)C=C2)=O)C[C@@H](O)C1)=O)C(C)(C)C |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | (S,R,S)-AHPC-PEG6-Azide Usage And Synthesis |
| Uses | Protein degrader builiding block (S,R,S)-AHPC-PEG6-Azide enables the synthesis of molecules for targeted protein degradation and PROTAC (proteolysis-targeting chimeras) technology. This conjugate contains a von Hippel–Lindau (VHL)-recruiting ligand, a linker with both hydrophobic and hydrophilic moieties, and a pendant azide for click chemistry with an alkyne on the target ligand. Because even slight alterations in ligands and crosslinkers can affect ternary complex formation between the target, E3 ligase, and PROTAC, many analogs are prepared to screen for optimal target degradation. When used with other protein degrader building blocks with a pendant azide group, parallel synthesis can be used to more quickly generate PROTAC libraries that feature variation in crosslinker length, composition, and E3 ligase ligand. | | reaction suitability | reaction type: click chemistry
reagent type: ligand-linker conjugate |
| | (S,R,S)-AHPC-PEG6-Azide Preparation Products And Raw materials |
|