| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
E3 ligase Ligand-Linker Conjugates 3 manufacturers
|
| | E3 ligase Ligand-Linker Conjugates 3 Basic information |
| Product Name: | E3 ligase Ligand-Linker Conjugates 3 | | Synonyms: | E3 ligase Ligand-Linker Conjugates 3;(S,R,S)-AHPC-PEG1-azide;VH032-PEG1-N3;VHL Ligand-Linker Conjugates 9;E3 Ligase Ligand-Linker Conjugates,(S,R,S) AHPC PEG1 N3,Inhibitor,(S,R,S)-AHPC-PEG-1-N3,(S,R,S)AHPCPEG1N3,inhibit;(2S,4R)-1-((S)-2-(2-(2-azidoethoxy)acetamido)-3,3-dimethylbutanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide;L-Prolinamide, N-[2-(2-azidoethoxy)acetyl]-3-methyl-L-valyl-4-hydroxy-N-[[4-(4-methyl-5-thiazolyl)phenyl]methyl]-, (4R)-;(S,R,S)-AHPC-PEG1-N3, 10 mM in DMSO | | CAS: | 2101200-09-1 | | MF: | C26H35N7O5S | | MW: | 557.67 | | EINECS: | | | Product Categories: | | | Mol File: | 2101200-09-1.mol |  |
| | E3 ligase Ligand-Linker Conjugates 3 Chemical Properties |
| storage temp. | 2-8°C | | form | Solid | | color | White to light yellow | | InChIKey | YVCURZJBLHZABY-ZRCGQRJVSA-N | | SMILES | O=C(NCC1=CC=C(C2=C(C)N=CS2)C=C1)[C@H](C[C@@H](O)C3)N3C([C@H](C(C)(C)C)NC(COCCN=[N+]=[N-])=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | E3 ligase Ligand-Linker Conjugates 3 Usage And Synthesis |
| Uses | Protein degrader builiding block (S,R,S)-AHPC-PEG1-azide enables the synthesis of molecules for targeted protein degradation and PROTAC (proteolysis-targeting chimeras) technology. This conjugate contains a von Hippel-Lindau (VHL)-recruiting ligand and a PEGylated crosslinker with pendant azide for click chemistry with a target ligand. Because even slight alterations in ligands and crosslinkers can affect ternary complex formation between the target, E3 ligase, and PROTAC, many analogs are prepared to screen for optimal target degradation. When used with other protein degrader building blocks with a pendant azide group, parallel synthesis can be used to more quickly generate PROTAC libraries that feature variation in crosslinker length, composition, and E3 ligase ligand. | | reaction suitability | reaction type: click chemistry
reagent type: ligand-linker conjugate | | IC 50 | VHL |
| | E3 ligase Ligand-Linker Conjugates 3 Preparation Products And Raw materials |
|