|
|
| | 4-(4-Chloro-phenyl)-thiazole-2-carboxylic acid Basic information |
| Product Name: | 4-(4-Chloro-phenyl)-thiazole-2-carboxylic acid | | Synonyms: | 4-(4-CHLOROPHENYL)-1,3-THIAZOLE-2-CARBOXYLIC ACID;2-Thiazolecarboxylic acid,4-(4-chlorophenyl)-;4-(4-chlorophenyl)-2-Thiazolecarboxylic acid;JR-14106, 4-(4-Chlorophenyl)thiazole-2-carboxylic acid, 97%;4-(4-Chloro-phenyl)-thiazole-2-carboxylic acid | | CAS: | 779320-20-6 | | MF: | C10H6ClNO2S | | MW: | 239.68 | | EINECS: | | | Product Categories: | | | Mol File: | 779320-20-6.mol |  |
| | 4-(4-Chloro-phenyl)-thiazole-2-carboxylic acid Chemical Properties |
| Boiling point | 454.9±37.0 °C(Predicted) | | density | 1.480±0.06 g/cm3(Predicted) | | pka | 2.77±0.10(Predicted) | | form | solid | | InChI | 1S/C10H6ClNO2S/c11-7-3-1-6(2-4-7)8-5-15-9(12-8)10(13)14/h1-5H,(H,13,14) | | InChIKey | JOMOAMJPPUFTSI-UHFFFAOYSA-N | | SMILES | O=C(O)C1=NC(C2=CC=C(Cl)C=C2)=CS1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-(4-Chloro-phenyl)-thiazole-2-carboxylic acid Usage And Synthesis |
| | 4-(4-Chloro-phenyl)-thiazole-2-carboxylic acid Preparation Products And Raw materials |
|