| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1-Boc-3-methylaminoazetidine Basic information |
| Product Name: | 1-Boc-3-methylaminoazetidine | | Synonyms: | 3-(methylamino)-1-azetidinecarboxylic acid tert-butyl ester;1-BOC-3-METHYLAMINOAZETIDINE HYDROCHLORIDE;1-Azetidinecarboxylicacid, 3-(MethylaMino)-, 1,1-diMethylethyl ester;1-BOC-3-METHYLAMINOAZATIDINE HYDROCHLORIDE;1-Boc-3-(methylamino)azetidine HCl;BOC-3-METHYLAMINOAZETIDINE HCl;1-tert-Butoxycarbonyl-3-(methylamino)azetidine;1-Boc-3-methylaminoazetine | | CAS: | 454703-20-9 | | MF: | C9H18N2O2 | | MW: | 186.25 | | EINECS: | | | Product Categories: | | | Mol File: | 454703-20-9.mol |  |
| | 1-Boc-3-methylaminoazetidine Chemical Properties |
| Boiling point | 249℃ | | density | 1.04 | | Fp | 105℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 9.23±0.20(Predicted) | | form | liquid | | color | Colourless | | Water Solubility | Slightly soluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C9H18N2O2/c1-9(2,3)13-8(12)11-5-7(6-11)10-4/h7,10H,5-6H2,1-4H3 | | InChIKey | CHRBSEYIEDTNSC-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC(NC)C1 | | CAS DataBase Reference | 454703-20-9 |
| Hazard Codes | T,N | | Risk Statements | 25-50 | | Safety Statements | 45-61 | | RIDADR | 2810 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 2933998090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 1-Boc-3-methylaminoazetidine Usage And Synthesis |
| Uses | 1-Boc-3-(methylamino)azetidine is used as pharmaceutical intermediates. |
| | 1-Boc-3-methylaminoazetidine Preparation Products And Raw materials |
|