|
|
| | D-Azetidine-2-carboxylic acid Basic information |
| | D-Azetidine-2-carboxylic acid Chemical Properties |
| Melting point | 209-211°C | | Boiling point | 242.0±33.0 °C(Predicted) | | density | 1.275±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Methanol (Slightly), Methanol (Slightly) | | form | Solid | | pka | 2.35±0.20(Predicted) | | color | White to Off-White | | Optical Rotation | Consistent with structure | | Stability: | Temperature Sensitive - Do Not Heat Above 55°C | | InChI | InChI=1S/C4H7NO2/c6-4(7)3-1-2-5-3/h3,5H,1-2H2,(H,6,7)/t3-/m1/s1 | | InChIKey | IADUEWIQBXOCDZ-GSVOUGTGSA-N | | SMILES | N1CC[C@@H]1C(O)=O | | CAS DataBase Reference | 7729-30-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25 | | HS Code | 29339900 |
| | D-Azetidine-2-carboxylic acid Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | D-Azetidine-2-Carboxylic Acid is a four-membered ring analog of L-Proline. A useful intermediate in the synthesis of polypeptides | | Definition | ChEBI: (R)-azetidine-2-carboxylic acid is an azetidine-2-carboxylic acid. It is an enantiomer of a (S)-azetidine-2-carboxylic acid. | | IC 50 | Non-cleavable Linker |
| | D-Azetidine-2-carboxylic acid Preparation Products And Raw materials |
|