- Fosinopril sodium
-
- $10.00
-
2021-08-13
- CAS:123599-78-0
- Min. Order: 1g
- Purity: 99
- Supply Ability: 52ton
- Fosinopril sodium
-
- $1.00
-
2019-08-08
- CAS:123599-78-0
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 500kg
|
| | [(2-Methyl-1-propionylpropoxy)(4-phenylbutyl)phosphinoyl]acetic acid Basic information |
| | [(2-Methyl-1-propionylpropoxy)(4-phenylbutyl)phosphinoyl]acetic acid Chemical Properties |
| Melting point | 48 - 55°C | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C19H29O6P/c1-4-18(22)24-19(15(2)3)25-26(23,14-17(20)21)13-9-8-12-16-10-6-5-7-11-16/h5-7,10-11,15,19H,4,8-9,12-14H2,1-3H3,(H,20,21) | | InChIKey | BGHVPSAAFKIBID-UHFFFAOYSA-N | | SMILES | C(O)(=O)CP(OC(OC(=O)CC)C(C)C)(CCCCC1=CC=CC=C1)=O |
| | [(2-Methyl-1-propionylpropoxy)(4-phenylbutyl)phosphinoyl]acetic acid Usage And Synthesis |
| Chemical Properties | White Low Melting Solid | | Uses | Fosinopril (F727800) intermediate. |
| | [(2-Methyl-1-propionylpropoxy)(4-phenylbutyl)phosphinoyl]acetic acid Preparation Products And Raw materials |
|