|
|
| | Tri-tert-butylphosphine Basic information | | Reaction |
| | Tri-tert-butylphosphine Chemical Properties |
| Melting point | 30-35 °C(lit.) | | Boiling point | 102-103 °C13 mm Hg(lit.) | | density | 0.861 g/mL at 25 °C | | Fp | 1 °F | | storage temp. | Flammables area | | form | solid | | Specific Gravity | 0.68 | | Water Solubility | insoluble | | Sensitive | Air & Moisture Sensitive | | Hydrolytic Sensitivity | 9: reacts extremely rapidly with atmospheric moisture - may be pyrophoric - glove box or sealed system required | | BRN | 1738613 | | InChI | InChI=1S/C12H27P/c1-10(2,3)13(11(4,5)6)12(7,8)9/h1-9H3 | | InChIKey | BWHDROKFUHTORW-UHFFFAOYSA-N | | SMILES | P(C(C)(C)C)(C(C)(C)C)C(C)(C)C | | CAS DataBase Reference | 13716-12-6(CAS DataBase Reference) | | NIST Chemistry Reference | Tri-tert-butylphosphine(13716-12-6) |
| Hazard Codes | F,C | | Risk Statements | 17-34-67-65-63-48/20-11 | | Safety Statements | 26-45-62-36/37/39-25-43-27-16 | | RIDADR | UN 2846 4.2/PG 1 | | WGK Germany | 3 | | F | 10-19-23 | | HazardClass | 4.2 | | PackingGroup | I | | HS Code | 29319090 | | Storage Class | 4.2 - Pyrophoric and self-heating hazardous materials | | Hazard Classifications | Carc. 2
Eye Dam. 1
Flam. Liq. 2
Pyr. Liq. 1
Skin Corr. 1B
STOT SE 3 |
| | Tri-tert-butylphosphine Usage And Synthesis |
| Reaction | Useful as a ligand in a variety of palladium-catalyzed C-N, C-O and C-C bond-forming reactions under mild conditions.
| | Chemical Properties | Colorless to light yellow liqui | | Uses | Tri-tert-butylphosphine is used primarily in the preparation of mono- and bidentate phosphine ligands in metal complexes for catalytic chiral asymmetric hydrogenations and other asymmetric reactions as well as transition metal coupling reactions. This reagent is also used in the preparation of other phosphines in catalytic polymerization reactions. | | Uses | Valuable ligand for several coupling reactions. This product is offered as the THF solution for more convenient handling. | | reaction suitability | reagent type: ligand
reaction type: Addition Reactions
reagent type: ligand
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reagent type: ligand
reaction type: Heck Reaction
reagent type: ligand
reaction type: Negishi Coupling
reagent type: ligand
reaction type: Sonogashira Coupling
reagent type: ligand
reaction type: Stille Coupling
reagent type: ligand
reaction type: Suzuki-Miyaura Coupling | | Synthesis | Under the protection of argon, the reaction solvent tetrahydrofuran was added to the dry reactor, and then calcium phosphide, tert-butyl bromide, and nickel catalyst were added sequentially, and then the reaction was heated up to 60-80 oC, and then the reaction was quenched by the addition of water, extracted, dried, and distilled under reduced pressure to obtain tri-tert-butylphosphine. |
| | Tri-tert-butylphosphine Preparation Products And Raw materials |
|