|
|
| | 10H-pyrido(3,2-b)(1,4)benzothiazine Basic information |
| Product Name: | 10H-pyrido(3,2-b)(1,4)benzothiazine | | Synonyms: | PYRIDO[3,2-B][1,4]BENZOTHIAZINE;1-Azaphenothiazine;1H-Pyrido[3,2-b][1,4]benzothiazine;10H-pyrido(3,2-b)(1,4)benzothiazine;10H-benzo[e]pyrido[3,2-b][1;NSC 277720;10H-Benzo[b]pyrido[2,3-e][1,4]thiazine;10H-benzo[e]pyrido[3,2-b][1,4]thiazine | | CAS: | 261-96-1 | | MF: | C11H8N2S | | MW: | 200.26 | | EINECS: | 205-973-7 | | Product Categories: | | | Mol File: | 261-96-1.mol |  |
| | 10H-pyrido(3,2-b)(1,4)benzothiazine Chemical Properties |
| Melting point | 110.0 to 114.0 °C | | Boiling point | 370°C(lit.) | | density | 1.293 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Dichloromethane (Slightly), DMSO (Slightly) | | form | Solid | | pka | 4.24±0.20(Predicted) | | color | Yellow to Dark Yellow | | InChI | InChI=1S/C11H8N2S/c1-2-5-9-8(4-1)13-11-10(14-9)6-3-7-12-11/h1-7H,(H,12,13) | | InChIKey | UKDZROJJLPDLDO-UHFFFAOYSA-N | | SMILES | S1C2=CC=CC=C2NC2=NC=CC=C12 |
| | 10H-pyrido(3,2-b)(1,4)benzothiazine Usage And Synthesis |
| Uses | 10H-Pyrido[3,2-b][1,4]benzothiazine has potential anti-cancer ability as seen through studies. | | Synthesis | General procedure for the synthesis of azaphenothiazine from the compound (CAS: 95873-97-5): 15.0 g (119.82 mmol) of intermediate (C) was suspended with 4.36 g (119.82 mmol) of hydrochloric acid in 470 mL of ethanol and the reaction was carried out at reflux for 12 h at 70 °C under nitrogen protection. After completion of the reaction, extraction was carried out with dichloromethane and distilled water and the organic layer was filtered through silica gel. After concentrating the organic solvent, it was purified by silica gel column chromatography (eluent: ethyl acetate/petroleum ether = 7:3, v/v) to give 20.64 g of intermediate (D) in 86% yield. | | References | [1] Patent: KR2015/12906, 2015, A. Location in patent: Paragraph 0197; 0204-0205
[2] Journal of the American Chemical Society, 1958, vol. 80, p. 1651,1653 |
| | 10H-pyrido(3,2-b)(1,4)benzothiazine Preparation Products And Raw materials |
|