|
|
| | di(2,4-xylyl) disulphide Basic information |
| Product Name: | di(2,4-xylyl) disulphide | | Synonyms: | di(2,4-xylyl) disulphide;Bis(2,4-xylyl) persulfide;2,4-Xylyl disulfide;Disulfide, bis(2,4-dimethylphenyl);1-[(2,4-dimethylphenyl)disulfanyl]-2,4-dimethylbenzene;Einecs 237-101-6;Vortioxetine Impurity 18;Vortioxetine impurity H | | CAS: | 13616-83-6 | | MF: | C16H18S2 | | MW: | 274.44 | | EINECS: | 237-101-6 | | Product Categories: | | | Mol File: | 13616-83-6.mol |  |
| | di(2,4-xylyl) disulphide Chemical Properties |
| Melting point | 265 °C | | Boiling point | 170-172 °C(Press: 3.5 Torr) | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | -20°C, Inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Oil | | color | Light Yellow | | InChI | InChI=1S/C16H18S2/c1-11-5-7-15(13(3)9-11)17-18-16-8-6-12(2)10-14(16)4/h5-10H,1-4H3 | | InChIKey | RPYHJOQRKNEXCU-UHFFFAOYSA-N | | SMILES | S(C1=CC=C(C)C=C1C)SC1=CC=C(C)C=C1C | | EPA Substance Registry System | Disulfide, bis(2,4-dimethylphenyl) (13616-83-6) |
| | di(2,4-xylyl) disulphide Usage And Synthesis |
| Uses | Bis(2,4-dimethylphenyl) Disulfide is an impurity of Vortioxetine Hydrobromide (V766000), a multimodal serotonergic agent that inhibits 5-HT1A, 5-HT1B, 5-HT3A, 5-HT7 receptor and SERT (1,2,3). Bis(2,4-dimethylphenyl) Disulfide used as a reactant in the preparation of vortioxetine salts using a new synthetic path. |
| | di(2,4-xylyl) disulphide Preparation Products And Raw materials |
|