|
|
| | 2-[(p-methyl-alpha-phenylbenzyl)oxy]ethyl(dimethyl)amine Basic information |
| | 2-[(p-methyl-alpha-phenylbenzyl)oxy]ethyl(dimethyl)amine Chemical Properties |
| Melting point | 151-155 °C | | Boiling point | 143 °C | | density | 1.014±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Oil | | pka | 8.73±0.28(Predicted) | | color | Colourless to Light Yellow | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C18H23NO/c1-15-9-11-17(12-10-15)18(20-14-13-19(2)3)16-7-5-4-6-8-16/h4-12,18H,13-14H2,1-3H3 | | InChIKey | PJUYQWIDNIAHIZ-UHFFFAOYSA-N | | SMILES | N(CCOC(c2ccc(cc2)C)c1ccccc1)(C)C |
| WGK Germany | WGK 3 | | HS Code | 2922199695 | | Storage Class | 11 - Combustible Solids |
| | 2-[(p-methyl-alpha-phenylbenzyl)oxy]ethyl(dimethyl)amine Usage And Synthesis |
| Uses | A diphenylhydramine analog classified as an antihistaminic. | | Uses | A diphenhydramine (D486900) analog classified as an antihistaminic. |
| | 2-[(p-methyl-alpha-phenylbenzyl)oxy]ethyl(dimethyl)amine Preparation Products And Raw materials |
|