| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | ethyldimethyl[2-[(2-methylphenyl)phenylmethoxy]ethyl]ammonium chloride Basic information |
| Product Name: | ethyldimethyl[2-[(2-methylphenyl)phenylmethoxy]ethyl]ammonium chloride | | Synonyms: | ethyldimethyl[2-[(2-methylphenyl)phenylmethoxy]ethyl]ammonium chloride;ethyl-dimethyl-[2-[(2-methylphenyl)-phenylmethoxy]ethyl]azanium;N-Ethyl-N,N-dimethyl-[2-(2-methylbe;Orphenadrine USP Related Compound B;Orphenadrine Impurity 7 (Orphenadrine USP RC B);Orphenadrine citrate USP Impurity B;Orphenadrine Impurity 1;Orphenadrine Related Compound B as Chloride | | CAS: | 93940-17-1 | | MF: | C20H28ClNO | | MW: | 333.89542 | | EINECS: | 3004102 | | Product Categories: | | | Mol File: | 93940-17-1.mol | ![ethyldimethyl[2-[(2-methylphenyl)phenylmethoxy]ethyl]ammonium chloride Structure](CAS/GIF/93940-17-1.gif) |
| | ethyldimethyl[2-[(2-methylphenyl)phenylmethoxy]ethyl]ammonium chloride Chemical Properties |
| storage temp. | 2-30°C | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C20H28NO.ClH/c1-5-21(3,4)14-15-22-16-18-11-7-9-13-20(18)19-12-8-6-10-17(19)2;/h6-13H,5,14-16H2,1-4H3;1H/q+1;/p-1 | | InChIKey | LHNAJQVIYDAYMX-UHFFFAOYSA-M | | SMILES | [Cl-].[N+](CCOCc1c(cccc1)c2c(cccc2)C)(CC)(C)C |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | ethyldimethyl[2-[(2-methylphenyl)phenylmethoxy]ethyl]ammonium chloride Usage And Synthesis |
| Uses | These Secondary Standards are qualified as Certified Reference Materials. These are suitable for use in several analytical applications including but not limited to pharma release testing, pharma method development for qualitative and quantitative analyses, food and beverage quality control testing, and other calibration requirements. |
| | ethyldimethyl[2-[(2-methylphenyl)phenylmethoxy]ethyl]ammonium chloride Preparation Products And Raw materials |
|